C11H10F2N2O — CID 138039104
4-[(3S,4R)-3,4-difluoropyrrolidin-1-yl]furo[3,2-c]pyridine (PubChem CID 138039104) has the molecular formula C11H10F2N2O and a molecular weight of 224.21 g/mol. Its IUPAC name is 4-[(3S,4R)-3,4-difluoropyrrolidin-1-yl]furo[3,2-c]pyridine.
| Compound Name | 4-[(3S,4R)-3,4-difluoropyrrolidin-1-yl]furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 138039104 |
| Molecular Formula | C11H10F2N2O |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 4-[(3S,4R)-3,4-difluoropyrrolidin-1-yl]furo[3,2-c]pyridine |
| SMILES | F[C@@H]1CN(c2nccc3occc23)C[C@@H]1F |
| InChI | InChI=1S/C11H10F2N2O/c12-8-5-15(6-9(8)13)11-7-2-4-16-10(7)1-3-14-11/h1-4,8-9H,5-6H2/t8-,9+ |
| InChIKey | YSPHQDUGAQVXEV-DTORHVGOSA-N |
| XLogP | 2.32 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |