C12H13ClN2O — CID 106535647
4-[3-(chloromethyl)pyrrolidin-1-yl]furo[3,2-c]pyridine (PubChem CID 106535647) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 4-[3-(chloromethyl)pyrrolidin-1-yl]furo[3,2-c]pyridine.
| Compound Name | 4-[3-(chloromethyl)pyrrolidin-1-yl]furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 106535647 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-[3-(chloromethyl)pyrrolidin-1-yl]furo[3,2-c]pyridine |
| SMILES | ClCC1CCN(c2nccc3occc23)C1 |
| InChI | InChI=1S/C12H13ClN2O/c13-7-9-2-5-15(8-9)12-10-3-6-16-11(10)1-4-14-12/h1,3-4,6,9H,2,5,7-8H2 |
| InChIKey | CGXVNCBATWUKJE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|