C13H17N3O3S — CID 97158066
(3R)-N-ethyl-1-furo[3,2-c]pyridin-4-ylpyrrolidine-3-sulfonamide (PubChem CID 97158066) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is (3R)-N-ethyl-1-furo[3,2-c]pyridin-4-ylpyrrolidine-3-sulfonamide.
| Compound Name | (3R)-N-ethyl-1-furo[3,2-c]pyridin-4-ylpyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 97158066 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (3R)-N-ethyl-1-furo[3,2-c]pyridin-4-ylpyrrolidine-3-sulfonamide |
| SMILES | CCNS(=O)(=O)[C@@H]1CCN(c2nccc3occc23)C1 |
| InChI | InChI=1S/C13H17N3O3S/c1-2-15-20(17,18)10-4-7-16(9-10)13-11-5-8-19-12(11)3-6-14-13/h3,5-6,8,10,15H,2,4,7,9H2,1H3/t10-/m1/s1 |
| InChIKey | YGTHKBQJXCGGHZ-SNVBAGLBSA-N |
| XLogP | 1.35 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |