About 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine
4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine (PubChem CID 172900403) has the molecular formula C14H14F2N2O
and a molecular weight of 264.27 g/mol. Its IUPAC name is 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine |
| PubChem CID | 172900403 |
| Molecular Formula | C14H14F2N2O |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine |
| SMILES | FC1(F)CC12CCN(c1nccc3occc13)CC2 |
| InChI | InChI=1S/C14H14F2N2O/c15-14(16)9-13(14)3-6-18(7-4-13)12-10-2-8-19-11(10)1-5-17-12/h1-2,5,8H,3-4,6-7,9H2 |
| InChIKey | KBVUDUZWORWVPL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine?
The IUPAC name of 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine (CID 172900403) is 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine.
What is the SMILES notation for 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine?
The canonical SMILES for 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine is FC1(F)CC12CCN(c1nccc3occc13)CC2.
What is the InChIKey of 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine?
The InChIKey is KBVUDUZWORWVPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N2O/c15-14(16)9-13(14)3-6-18(7-4-13)12-10-2-8-19-11(10)1-5-17-12/h1-2,5,8H,3-4,6-7,9H2.
What are the key properties of 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine?
4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine has a molecular weight of 264.27 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)furo[3,2-c]pyridine is sourced from PubChem (CID 172900403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).