About 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid
1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid (PubChem CID 56865178) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid |
| PubChem CID | 56865178 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(CCc2ccccc2)CCN(c2nccc3occc23)CC1 |
| InChI | InChI=1S/C21H22N2O3/c24-20(25)21(9-6-16-4-2-1-3-5-16)10-13-23(14-11-21)19-17-8-15-26-18(17)7-12-22-19/h1-5,7-8,12,15H,6,9-11,13-14H2,(H,24,25) |
| InChIKey | LVFXDBGNFACBIL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid?
The IUPAC name of 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid (CID 56865178) is 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid.
What is the SMILES notation for 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid?
The canonical SMILES for 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid is O=C(O)C1(CCc2ccccc2)CCN(c2nccc3occc23)CC1.
What is the InChIKey of 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid?
The InChIKey is LVFXDBGNFACBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3/c24-20(25)21(9-6-16-4-2-1-3-5-16)10-13-23(14-11-21)19-17-8-15-26-18(17)7-12-22-19/h1-5,7-8,12,15H,6,9-11,13-14H2,(H,24,25).
What are the key properties of 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid?
1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid has a molecular weight of 350.42 g/mol, XLogP of 4.13, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-furo[3,2-c]pyridin-4-yl-4-(2-phenylethyl)piperidine-4-carboxylic acid is sourced from PubChem (CID 56865178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).