C14H18N2O2 — CID 107407467
1-furo[3,2-c]pyridin-4-yl-4-methylazepan-4-ol (PubChem CID 107407467) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-furo[3,2-c]pyridin-4-yl-4-methylazepan-4-ol.
| Compound Name | 1-furo[3,2-c]pyridin-4-yl-4-methylazepan-4-ol |
|---|---|
| PubChem CID | 107407467 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-furo[3,2-c]pyridin-4-yl-4-methylazepan-4-ol |
| SMILES | CC1(O)CCCN(c2nccc3occc23)CC1 |
| InChI | InChI=1S/C14H18N2O2/c1-14(17)5-2-8-16(9-6-14)13-11-4-10-18-12(11)3-7-15-13/h3-4,7,10,17H,2,5-6,8-9H2,1H3 |
| InChIKey | PNLAQVMMAFQXME-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |