C16H22N4O2 — CID 166603589
1-(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)-1,3,3-trimethylurea (PubChem CID 166603589) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)-1,3,3-trimethylurea.
| Compound Name | 1-(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 166603589 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-(1-furo[3,2-c]pyridin-4-ylpiperidin-4-yl)-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)C1CCN(c2nccc3occc23)CC1 |
| InChI | InChI=1S/C16H22N4O2/c1-18(2)16(21)19(3)12-5-9-20(10-6-12)15-13-7-11-22-14(13)4-8-17-15/h4,7-8,11-12H,5-6,9-10H2,1-3H3 |
| InChIKey | PXESRJRBECZTSH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |