C11H10N4O — CID 106535479
1-furo[3,2-c]pyridin-4-yl-4-methylpyrazol-3-amine (PubChem CID 106535479) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 1-furo[3,2-c]pyridin-4-yl-4-methylpyrazol-3-amine.
| Compound Name | 1-furo[3,2-c]pyridin-4-yl-4-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 106535479 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1-furo[3,2-c]pyridin-4-yl-4-methylpyrazol-3-amine |
| SMILES | Cc1cn(-c2nccc3occc23)nc1N |
| InChI | InChI=1S/C11H10N4O/c1-7-6-15(14-10(7)12)11-8-3-5-16-9(8)2-4-13-11/h2-6H,1H3,(H2,12,14) |
| InChIKey | LZTWYSQBMSQMKC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |