C17H22BrN3 — CID 106543360
N-[1-(aminomethyl)-3-methylcyclohexyl]-5-bromoisoquinolin-1-amine (PubChem CID 106543360) has the molecular formula C17H22BrN3 and a molecular weight of 348.29 g/mol. Its IUPAC name is N-[1-(aminomethyl)-3-methylcyclohexyl]-5-bromoisoquinolin-1-amine.
| Compound Name | N-[1-(aminomethyl)-3-methylcyclohexyl]-5-bromoisoquinolin-1-amine |
|---|---|
| PubChem CID | 106543360 |
| Molecular Formula | C17H22BrN3 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-[1-(aminomethyl)-3-methylcyclohexyl]-5-bromoisoquinolin-1-amine |
| SMILES | CC1CCCC(CN)(Nc2nccc3c(Br)cccc23)C1 |
| InChI | InChI=1S/C17H22BrN3/c1-12-4-3-8-17(10-12,11-19)21-16-14-5-2-6-15(18)13(14)7-9-20-16/h2,5-7,9,12H,3-4,8,10-11,19H2,1H3,(H,20,21) |
| InChIKey | AJCXYKFUEJOUMN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |