C11H19N3O — CID 106548356
2-(4-amino-3,3-dimethylbutyl)-5-methylpyridazin-3-one (PubChem CID 106548356) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(4-amino-3,3-dimethylbutyl)-5-methylpyridazin-3-one.
| Compound Name | 2-(4-amino-3,3-dimethylbutyl)-5-methylpyridazin-3-one |
|---|---|
| PubChem CID | 106548356 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-(4-amino-3,3-dimethylbutyl)-5-methylpyridazin-3-one |
| SMILES | Cc1cnn(CCC(C)(C)CN)c(=O)c1 |
| InChI | InChI=1S/C11H19N3O/c1-9-6-10(15)14(13-7-9)5-4-11(2,3)8-12/h6-7H,4-5,8,12H2,1-3H3 |
| InChIKey | PIGFFVOQHFUGBX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |