C12H19N3OS — CID 106548724
2,2-dimethyl-5-(4-methyl-6-oxopyridazin-1-yl)pentanethioamide (PubChem CID 106548724) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 2,2-dimethyl-5-(4-methyl-6-oxopyridazin-1-yl)pentanethioamide.
| Compound Name | 2,2-dimethyl-5-(4-methyl-6-oxopyridazin-1-yl)pentanethioamide |
|---|---|
| PubChem CID | 106548724 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2,2-dimethyl-5-(4-methyl-6-oxopyridazin-1-yl)pentanethioamide |
| SMILES | Cc1cnn(CCCC(C)(C)C(N)=S)c(=O)c1 |
| InChI | InChI=1S/C12H19N3OS/c1-9-7-10(16)15(14-8-9)6-4-5-12(2,3)11(13)17/h7-8H,4-6H2,1-3H3,(H2,13,17) |
| InChIKey | NVMCFIZGWRWVKC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|