C8H12N2O3 — CID 106548849
2-(2,3-dihydroxypropyl)-5-methylpyridazin-3-one (PubChem CID 106548849) has the molecular formula C8H12N2O3 and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)-5-methylpyridazin-3-one.
| Compound Name | 2-(2,3-dihydroxypropyl)-5-methylpyridazin-3-one |
|---|---|
| PubChem CID | 106548849 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)-5-methylpyridazin-3-one |
| SMILES | Cc1cnn(CC(O)CO)c(=O)c1 |
| InChI | InChI=1S/C8H12N2O3/c1-6-2-8(13)10(9-3-6)4-7(12)5-11/h2-3,7,11-12H,4-5H2,1H3 |
| InChIKey | NSZAETDPEZJAAX-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |