About methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate
methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate (PubChem CID 10655088) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate.
Analyze methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate?
The IUPAC name of methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate (CID 10655088) is methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate.
What is the SMILES notation for methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate?
The canonical SMILES for methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate is CCO[C@H]1C(C(=O)OC)=C(C)[C@H]1C.
What is the InChIKey of methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate?
The InChIKey is JQRFQNCJLRJZAO-VXNVDRBHSA-N. The full InChI is InChI=1S/C10H16O3/c1-5-13-9-7(3)6(2)8(9)10(11)12-4/h7,9H,5H2,1-4H3/t7-,9-/m1/s1.
What are the key properties of methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate?
methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate has a molecular weight of 184.23 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R,4R)-4-ethoxy-2,3-dimethylcyclobutene-1-carboxylate is sourced from PubChem (CID 10655088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).