C16H28O3 — CID 10967513
ethyl 2-(3,4,5,5-tetraethyl-2H-furan-2-yl)acetate (PubChem CID 10967513) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is ethyl 2-(3,4,5,5-tetraethyl-2H-furan-2-yl)acetate.
| Compound Name | ethyl 2-(3,4,5,5-tetraethyl-2H-furan-2-yl)acetate |
|---|---|
| PubChem CID | 10967513 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | ethyl 2-(3,4,5,5-tetraethyl-2H-furan-2-yl)acetate |
| SMILES | CCOC(=O)CC1OC(CC)(CC)C(CC)=C1CC |
| InChI | InChI=1S/C16H28O3/c1-6-12-13(7-2)16(8-3,9-4)19-14(12)11-15(17)18-10-5/h14H,6-11H2,1-5H3 |
| InChIKey | HBTSALOUZFFDCB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|