About ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane
ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane (PubChem CID 91389858) has the molecular formula C17H28O6
and a molecular weight of 328.41 g/mol. Its IUPAC name is ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane.
Molecular Properties
| Compound Name | ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane |
| PubChem CID | 91389858 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane |
| SMILES | C1CCOC1.CCOC(=O)C1C(OC)C=C(C)CC1OC(C)=O |
| InChI | InChI=1S/C13H20O5.C4H8O/c1-5-17-13(15)12-10(16-4)6-8(2)7-11(12)18-9(3)14;1-2-4-5-3-1/h6,10-12H,5,7H2,1-4H3;1-4H2 |
| InChIKey | HDVCFMIVWAVSEI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane?
The IUPAC name of ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane (CID 91389858) is ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane.
What is the SMILES notation for ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane?
The canonical SMILES for ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane is C1CCOC1.CCOC(=O)C1C(OC)C=C(C)CC1OC(C)=O.
What is the InChIKey of ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane?
The InChIKey is HDVCFMIVWAVSEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O5.C4H8O/c1-5-17-13(15)12-10(16-4)6-8(2)7-11(12)18-9(3)14;1-2-4-5-3-1/h6,10-12H,5,7H2,1-4H3;1-4H2.
What are the key properties of ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane?
ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane has a molecular weight of 328.41 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-acetyloxy-2-methoxy-4-methylcyclohex-3-ene-1-carboxylate;oxolane is sourced from PubChem (CID 91389858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).