C18H30O4 — CID 121257118
[(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl] acetate (PubChem CID 121257118) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is [(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl] acetate.
| Compound Name | [(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl] acetate |
|---|---|
| PubChem CID | 121257118 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl] acetate |
| SMILES | CO[C@H]1/C=C/CCCCCOC/C(C)=C\[C@@H](C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H30O4/c1-14-12-15(2)18(22-16(3)19)17(20-4)10-8-6-5-7-9-11-21-13-14/h8,10,12,15,17-18H,5-7,9,11,13H2,1-4H3/b10-8+,14-12-/t15-,17+,18+/m1/s1 |
| InChIKey | RLOWBCQWIHYMKF-HNCXYEKPSA-N |
| XLogP | 3.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|