C12H13ClN4O2 — CID 106551618
2-(6-chloropyrazine-2-carbonyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 106551618) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-(6-chloropyrazine-2-carbonyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-(6-chloropyrazine-2-carbonyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 106551618 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-(6-chloropyrazine-2-carbonyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C(c1cncc(Cl)n1)N1CCN2C(=O)CCC2C1 |
| InChI | InChI=1S/C12H13ClN4O2/c13-10-6-14-5-9(15-10)12(19)16-3-4-17-8(7-16)1-2-11(17)18/h5-6,8H,1-4,7H2 |
| InChIKey | BOARSFURGAWKNP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |