C12H16ClN3O — CID 103186815
(6-chloropyrazin-2-yl)-(3,5-dimethylpiperidin-1-yl)methanone (PubChem CID 103186815) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is (6-chloropyrazin-2-yl)-(3,5-dimethylpiperidin-1-yl)methanone.
| Compound Name | (6-chloropyrazin-2-yl)-(3,5-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 103186815 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (6-chloropyrazin-2-yl)-(3,5-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CC(C)CN(C(=O)c2cncc(Cl)n2)C1 |
| InChI | InChI=1S/C12H16ClN3O/c1-8-3-9(2)7-16(6-8)12(17)10-4-14-5-11(13)15-10/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | TZICXMMMYQYEKW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |