C11H15ClN4O3S — CID 106550944
N-[1-(6-chloropyrazine-2-carbonyl)piperidin-4-yl]methanesulfonamide (PubChem CID 106550944) has the molecular formula C11H15ClN4O3S and a molecular weight of 318.79 g/mol. Its IUPAC name is N-[1-(6-chloropyrazine-2-carbonyl)piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-(6-chloropyrazine-2-carbonyl)piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 106550944 |
| Molecular Formula | C11H15ClN4O3S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-[1-(6-chloropyrazine-2-carbonyl)piperidin-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(C(=O)c2cncc(Cl)n2)CC1 |
| InChI | InChI=1S/C11H15ClN4O3S/c1-20(18,19)15-8-2-4-16(5-3-8)11(17)9-6-13-7-10(12)14-9/h6-8,15H,2-5H2,1H3 |
| InChIKey | PDLWARFJMDXRRE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |