C16H23N5 — CID 106552611
N-methyl-1-phenyl-N-(2-piperazin-1-ylethyl)imidazol-2-amine (PubChem CID 106552611) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-methyl-1-phenyl-N-(2-piperazin-1-ylethyl)imidazol-2-amine.
| Compound Name | N-methyl-1-phenyl-N-(2-piperazin-1-ylethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106552611 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N-methyl-1-phenyl-N-(2-piperazin-1-ylethyl)imidazol-2-amine |
| SMILES | CN(CCN1CCNCC1)c1nccn1-c1ccccc1 |
| InChI | InChI=1S/C16H23N5/c1-19(13-14-20-10-7-17-8-11-20)16-18-9-12-21(16)15-5-3-2-4-6-15/h2-6,9,12,17H,7-8,10-11,13-14H2,1H3 |
| InChIKey | YHCDWJSJAQIOQZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |