C16H23N5 — CID 63266342
N,4-dimethyl-N-(2-piperazin-1-ylethyl)phthalazin-1-amine (PubChem CID 63266342) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is N,4-dimethyl-N-(2-piperazin-1-ylethyl)phthalazin-1-amine.
| Compound Name | N,4-dimethyl-N-(2-piperazin-1-ylethyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 63266342 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N,4-dimethyl-N-(2-piperazin-1-ylethyl)phthalazin-1-amine |
| SMILES | Cc1nnc(N(C)CCN2CCNCC2)c2ccccc12 |
| InChI | InChI=1S/C16H23N5/c1-13-14-5-3-4-6-15(14)16(19-18-13)20(2)11-12-21-9-7-17-8-10-21/h3-6,17H,7-12H2,1-2H3 |
| InChIKey | YWHHXFNFCHBLQP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |