About N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine
N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine (PubChem CID 106553235) has the molecular formula C12H24N4
and a molecular weight of 224.35 g/mol. Its IUPAC name is N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine |
| PubChem CID | 106553235 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine |
| SMILES | CNCCCN(C)c1nccn1CC(C)C |
| InChI | InChI=1S/C12H24N4/c1-11(2)10-16-9-7-14-12(16)15(4)8-5-6-13-3/h7,9,11,13H,5-6,8,10H2,1-4H3 |
| InChIKey | ZZDYYFBUTVCBLS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine?
The IUPAC name of N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine (CID 106553235) is N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine.
What is the SMILES notation for N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine?
The canonical SMILES for N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine is CNCCCN(C)c1nccn1CC(C)C.
What is the InChIKey of N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine?
The InChIKey is ZZDYYFBUTVCBLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4/c1-11(2)10-16-9-7-14-12(16)15(4)8-5-6-13-3/h7,9,11,13H,5-6,8,10H2,1-4H3.
What are the key properties of N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine?
N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine has a molecular weight of 224.35 g/mol, XLogP of 1.58, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-N'-[1-(2-methylpropyl)imidazol-2-yl]propane-1,3-diamine is sourced from PubChem (CID 106553235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).