About 1-ethylcyclohexan-1-ol;zinc
1-ethylcyclohexan-1-ol;zinc (PubChem CID 10655352) has the molecular formula C8H15OZn-
and a molecular weight of 192.60 g/mol. Its IUPAC name is 1-ethylcyclohexan-1-ol;zinc.
Molecular Properties
| Compound Name | 1-ethylcyclohexan-1-ol;zinc |
| PubChem CID | 10655352 |
| Molecular Formula | C8H15OZn- |
| Molecular Weight | 192.60 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 1-ethylcyclohexan-1-ol;zinc |
| SMILES | [CH2-]CC1(O)CCCCC1.[Zn] |
| InChI | InChI=1S/C8H15O.Zn/c1-2-8(9)6-4-3-5-7-8;/h9H,1-7H2;/q-1; |
| InChIKey | FLBMWHZUKQWFMG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.60 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylcyclohexan-1-ol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylcyclohexan-1-ol;zinc?
The IUPAC name of 1-ethylcyclohexan-1-ol;zinc (CID 10655352) is 1-ethylcyclohexan-1-ol;zinc.
What is the SMILES notation for 1-ethylcyclohexan-1-ol;zinc?
The canonical SMILES for 1-ethylcyclohexan-1-ol;zinc is [CH2-]CC1(O)CCCCC1.[Zn].
What is the InChIKey of 1-ethylcyclohexan-1-ol;zinc?
The InChIKey is FLBMWHZUKQWFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O.Zn/c1-2-8(9)6-4-3-5-7-8;/h9H,1-7H2;/q-1;.
What are the key properties of 1-ethylcyclohexan-1-ol;zinc?
1-ethylcyclohexan-1-ol;zinc has a molecular weight of 192.60 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylcyclohexan-1-ol;zinc is sourced from PubChem (CID 10655352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).