C14H17ClFN3 — CID 106554114
N-(2-chloro-4-fluorophenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine (PubChem CID 106554114) has the molecular formula C14H17ClFN3 and a molecular weight of 281.76 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine.
| Compound Name | N-(2-chloro-4-fluorophenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106554114 |
| Molecular Formula | C14H17ClFN3 |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine |
| SMILES | Cc1cn(CC(C)C)c(Nc2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C14H17ClFN3/c1-9(2)7-19-8-10(3)17-14(19)18-13-5-4-11(16)6-12(13)15/h4-6,8-9H,7H2,1-3H3,(H,17,18) |
| InChIKey | AWAOMEQMANIMGZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |