C14H18IN3 — CID 106554218
N-(3-iodophenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine (PubChem CID 106554218) has the molecular formula C14H18IN3 and a molecular weight of 355.22 g/mol. Its IUPAC name is N-(3-iodophenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine.
| Compound Name | N-(3-iodophenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106554218 |
| Molecular Formula | C14H18IN3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-(3-iodophenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine |
| SMILES | Cc1cn(CC(C)C)c(Nc2cccc(I)c2)n1 |
| InChI | InChI=1S/C14H18IN3/c1-10(2)8-18-9-11(3)16-14(18)17-13-6-4-5-12(15)7-13/h4-7,9-10H,8H2,1-3H3,(H,16,17) |
| InChIKey | WXTMLZYVLDBLMM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|