C15H20BrN3 — CID 107581439
N-(3-bromo-5-methylphenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine (PubChem CID 107581439) has the molecular formula C15H20BrN3 and a molecular weight of 322.25 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine.
| Compound Name | N-(3-bromo-5-methylphenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 107581439 |
| Molecular Formula | C15H20BrN3 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-4-methyl-1-(2-methylpropyl)imidazol-2-amine |
| SMILES | Cc1cc(Br)cc(Nc2nc(C)cn2CC(C)C)c1 |
| InChI | InChI=1S/C15H20BrN3/c1-10(2)8-19-9-12(4)17-15(19)18-14-6-11(3)5-13(16)7-14/h5-7,9-10H,8H2,1-4H3,(H,17,18) |
| InChIKey | IEFYZJKCMSFOGN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |