C16H20IN3 — CID 106554243
N-cyclohexyl-1-(3-iodophenyl)-4-methylimidazol-2-amine (PubChem CID 106554243) has the molecular formula C16H20IN3 and a molecular weight of 381.26 g/mol. Its IUPAC name is N-cyclohexyl-1-(3-iodophenyl)-4-methylimidazol-2-amine.
| Compound Name | N-cyclohexyl-1-(3-iodophenyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106554243 |
| Molecular Formula | C16H20IN3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-cyclohexyl-1-(3-iodophenyl)-4-methylimidazol-2-amine |
| SMILES | Cc1cn(-c2cccc(I)c2)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C16H20IN3/c1-12-11-20(15-9-5-6-13(17)10-15)16(18-12)19-14-7-3-2-4-8-14/h5-6,9-11,14H,2-4,7-8H2,1H3,(H,18,19) |
| InChIKey | FJGCFTQELHPSQM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|