C14H21N5 — CID 106562135
N-cyclohexyl-4-methyl-1-(1-methylpyrazol-4-yl)imidazol-2-amine (PubChem CID 106562135) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is N-cyclohexyl-4-methyl-1-(1-methylpyrazol-4-yl)imidazol-2-amine.
| Compound Name | N-cyclohexyl-4-methyl-1-(1-methylpyrazol-4-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 106562135 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N-cyclohexyl-4-methyl-1-(1-methylpyrazol-4-yl)imidazol-2-amine |
| SMILES | Cc1cn(-c2cnn(C)c2)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C14H21N5/c1-11-9-19(13-8-15-18(2)10-13)14(16-11)17-12-6-4-3-5-7-12/h8-10,12H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | MOCOWIBHBDFHIS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |