C13H16IN3O — CID 106554281
N-(2-iodophenyl)-1-(2-methoxyethyl)-4-methylimidazol-2-amine (PubChem CID 106554281) has the molecular formula C13H16IN3O and a molecular weight of 357.20 g/mol. Its IUPAC name is N-(2-iodophenyl)-1-(2-methoxyethyl)-4-methylimidazol-2-amine.
| Compound Name | N-(2-iodophenyl)-1-(2-methoxyethyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106554281 |
| Molecular Formula | C13H16IN3O |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N-(2-iodophenyl)-1-(2-methoxyethyl)-4-methylimidazol-2-amine |
| SMILES | COCCn1cc(C)nc1Nc1ccccc1I |
| InChI | InChI=1S/C13H16IN3O/c1-10-9-17(7-8-18-2)13(15-10)16-12-6-4-3-5-11(12)14/h3-6,9H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | OMNNBXPYMMQDPE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|