C12H23NO — CID 10655543
3-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]propan-1-ol (PubChem CID 10655543) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 3-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]propan-1-ol.
| Compound Name | 3-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 10655543 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]propan-1-ol |
| SMILES | C[C@@H]1CC[C@@H](CCCO)N2CCC[C@@H]12 |
| InChI | InChI=1S/C12H23NO/c1-10-6-7-11(4-3-9-14)13-8-2-5-12(10)13/h10-12,14H,2-9H2,1H3/t10-,11-,12+/m1/s1 |
| InChIKey | CUGACFPMWHBUOF-UTUOFQBUSA-N |
| XLogP | 2.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |