C11H21N3O2 — CID 106556138
N,1-bis(1-methoxypropan-2-yl)imidazol-2-amine (PubChem CID 106556138) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is N,1-bis(1-methoxypropan-2-yl)imidazol-2-amine.
| Compound Name | N,1-bis(1-methoxypropan-2-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 106556138 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | N,1-bis(1-methoxypropan-2-yl)imidazol-2-amine |
| SMILES | COCC(C)Nc1nccn1C(C)COC |
| InChI | InChI=1S/C11H21N3O2/c1-9(7-15-3)13-11-12-5-6-14(11)10(2)8-16-4/h5-6,9-10H,7-8H2,1-4H3,(H,12,13) |
| InChIKey | BAGRYPARUKFJDW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |