C12H23N3O — CID 106557283
N-(1-methoxypropan-2-yl)-1-(3-methylbutyl)imidazol-2-amine (PubChem CID 106557283) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-1-(3-methylbutyl)imidazol-2-amine.
| Compound Name | N-(1-methoxypropan-2-yl)-1-(3-methylbutyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106557283 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-1-(3-methylbutyl)imidazol-2-amine |
| SMILES | COCC(C)Nc1nccn1CCC(C)C |
| InChI | InChI=1S/C12H23N3O/c1-10(2)5-7-15-8-6-13-12(15)14-11(3)9-16-4/h6,8,10-11H,5,7,9H2,1-4H3,(H,13,14) |
| InChIKey | OWLSQYHBAMFHIA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |