C8H9ClN2O2 — CID 10655673
2-chloro-5-hydroxy-N,N-dimethylpyridine-3-carboxamide (PubChem CID 10655673) has the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. Its IUPAC name is 2-chloro-5-hydroxy-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 2-chloro-5-hydroxy-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 10655673 |
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-chloro-5-hydroxy-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1cc(O)cnc1Cl |
| InChI | InChI=1S/C8H9ClN2O2/c1-11(2)8(13)6-3-5(12)4-10-7(6)9/h3-4,12H,1-2H3 |
| InChIKey | SSHDBYHPYUJCOW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|