C13H14F3N3 — CID 106556796
N-butyl-1-(2,3,4-trifluorophenyl)imidazol-2-amine (PubChem CID 106556796) has the molecular formula C13H14F3N3 and a molecular weight of 269.27 g/mol. Its IUPAC name is N-butyl-1-(2,3,4-trifluorophenyl)imidazol-2-amine.
| Compound Name | N-butyl-1-(2,3,4-trifluorophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106556796 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-butyl-1-(2,3,4-trifluorophenyl)imidazol-2-amine |
| SMILES | CCCCNc1nccn1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H14F3N3/c1-2-3-6-17-13-18-7-8-19(13)10-5-4-9(14)11(15)12(10)16/h4-5,7-8H,2-3,6H2,1H3,(H,17,18) |
| InChIKey | PWEQWDREJVACAK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|