C12H10F3N3 — CID 106556824
N-prop-2-enyl-1-(2,3,4-trifluorophenyl)imidazol-2-amine (PubChem CID 106556824) has the molecular formula C12H10F3N3 and a molecular weight of 253.23 g/mol. Its IUPAC name is N-prop-2-enyl-1-(2,3,4-trifluorophenyl)imidazol-2-amine.
| Compound Name | N-prop-2-enyl-1-(2,3,4-trifluorophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106556824 |
| Molecular Formula | C12H10F3N3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-prop-2-enyl-1-(2,3,4-trifluorophenyl)imidazol-2-amine |
| SMILES | C=CCNc1nccn1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H10F3N3/c1-2-5-16-12-17-6-7-18(12)9-4-3-8(13)10(14)11(9)15/h2-4,6-7H,1,5H2,(H,16,17) |
| InChIKey | RXJLLYZFDHDZHX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|