C13H14BrN3 — CID 106555655
1-(2-bromo-4-methylphenyl)-N-prop-2-enylimidazol-2-amine (PubChem CID 106555655) has the molecular formula C13H14BrN3 and a molecular weight of 292.18 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-N-prop-2-enylimidazol-2-amine.
| Compound Name | 1-(2-bromo-4-methylphenyl)-N-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106555655 |
| Molecular Formula | C13H14BrN3 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-N-prop-2-enylimidazol-2-amine |
| SMILES | C=CCNc1nccn1-c1ccc(C)cc1Br |
| InChI | InChI=1S/C13H14BrN3/c1-3-6-15-13-16-7-8-17(13)12-5-4-10(2)9-11(12)14/h3-5,7-9H,1,6H2,2H3,(H,15,16) |
| InChIKey | VIWAOUJMSZUUNY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|