C12H12BrN3 — CID 106558616
1-(4-bromophenyl)-N-prop-2-enylimidazol-2-amine (PubChem CID 106558616) has the molecular formula C12H12BrN3 and a molecular weight of 278.15 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-prop-2-enylimidazol-2-amine.
| Compound Name | 1-(4-bromophenyl)-N-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106558616 |
| Molecular Formula | C12H12BrN3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 1-(4-bromophenyl)-N-prop-2-enylimidazol-2-amine |
| SMILES | C=CCNc1nccn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H12BrN3/c1-2-7-14-12-15-8-9-16(12)11-5-3-10(13)4-6-11/h2-6,8-9H,1,7H2,(H,14,15) |
| InChIKey | DJSZEOPRKPAWTG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|