C12H19N3 — CID 106557738
1-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]imidazol-2-amine (PubChem CID 106557738) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 1-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]imidazol-2-amine.
| Compound Name | 1-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106557738 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]imidazol-2-amine |
| SMILES | CC(C1CC2CCC1C2)n1ccnc1N |
| InChI | InChI=1S/C12H19N3/c1-8(15-5-4-14-12(15)13)11-7-9-2-3-10(11)6-9/h4-5,8-11H,2-3,6-7H2,1H3,(H2,13,14) |
| InChIKey | JSCISSZXKMNFDE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |