C13H17N3 — CID 106558212
1-(2,5-dimethylphenyl)-N,4-dimethylimidazol-2-amine (PubChem CID 106558212) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N,4-dimethylimidazol-2-amine.
| Compound Name | 1-(2,5-dimethylphenyl)-N,4-dimethylimidazol-2-amine |
|---|---|
| PubChem CID | 106558212 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N,4-dimethylimidazol-2-amine |
| SMILES | CNc1nc(C)cn1-c1cc(C)ccc1C |
| InChI | InChI=1S/C13H17N3/c1-9-5-6-10(2)12(7-9)16-8-11(3)15-13(16)14-4/h5-8H,1-4H3,(H,14,15) |
| InChIKey | CQTNWAUOYYNVPU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |