C11H12ClN3 — CID 106558479
1-(4-chlorophenyl)-N,4-dimethylimidazol-2-amine (PubChem CID 106558479) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,4-dimethylimidazol-2-amine.
| Compound Name | 1-(4-chlorophenyl)-N,4-dimethylimidazol-2-amine |
|---|---|
| PubChem CID | 106558479 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 1-(4-chlorophenyl)-N,4-dimethylimidazol-2-amine |
| SMILES | CNc1nc(C)cn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClN3/c1-8-7-15(11(13-2)14-8)10-5-3-9(12)4-6-10/h3-7H,1-2H3,(H,13,14) |
| InChIKey | UNUJFBMDTWBBIH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |