C12H15N3O2S — CID 106558108
N,4-dimethyl-1-(4-methylsulfonylphenyl)imidazol-2-amine (PubChem CID 106558108) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is N,4-dimethyl-1-(4-methylsulfonylphenyl)imidazol-2-amine.
| Compound Name | N,4-dimethyl-1-(4-methylsulfonylphenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106558108 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N,4-dimethyl-1-(4-methylsulfonylphenyl)imidazol-2-amine |
| SMILES | CNc1nc(C)cn1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H15N3O2S/c1-9-8-15(12(13-2)14-9)10-4-6-11(7-5-10)18(3,16)17/h4-8H,1-3H3,(H,13,14) |
| InChIKey | YOOWHSYNNLESIR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |