C12H12N2O2S2 — CID 139885159
2-methyl-7-methylsulfonyl-4H-imidazo[2,1-c][1,4]benzothiazine (PubChem CID 139885159) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-methyl-7-methylsulfonyl-4H-imidazo[2,1-c][1,4]benzothiazine.
| Compound Name | 2-methyl-7-methylsulfonyl-4H-imidazo[2,1-c][1,4]benzothiazine |
|---|---|
| PubChem CID | 139885159 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-methyl-7-methylsulfonyl-4H-imidazo[2,1-c][1,4]benzothiazine |
| SMILES | Cc1cn2c(n1)CSc1cc(S(C)(=O)=O)ccc1-2 |
| InChI | InChI=1S/C12H12N2O2S2/c1-8-6-14-10-4-3-9(18(2,15)16)5-11(10)17-7-12(14)13-8/h3-6H,7H2,1-2H3 |
| InChIKey | DYOZOGULWIOYGW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |