C18H16ClN3O3S — CID 54379362
1-(4-chlorophenyl)-N-methyl-2-(4-methylsulfonylphenyl)imidazole-4-carboxamide (PubChem CID 54379362) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-methyl-2-(4-methylsulfonylphenyl)imidazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-methyl-2-(4-methylsulfonylphenyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 54379362 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 1-(4-chlorophenyl)-N-methyl-2-(4-methylsulfonylphenyl)imidazole-4-carboxamide |
| SMILES | CNC(=O)c1cn(-c2ccc(Cl)cc2)c(-c2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C18H16ClN3O3S/c1-20-18(23)16-11-22(14-7-5-13(19)6-8-14)17(21-16)12-3-9-15(10-4-12)26(2,24)25/h3-11H,1-2H3,(H,20,23) |
| InChIKey | UYVZYCYUQSSTAX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |