C17H12ClN3O2S — CID 10784589
2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)imidazole-4-carbonitrile (PubChem CID 10784589) has the molecular formula C17H12ClN3O2S and a molecular weight of 357.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)imidazole-4-carbonitrile.
| Compound Name | 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 10784589 |
| Molecular Formula | C17H12ClN3O2S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(4-methylsulfonylphenyl)imidazole-4-carbonitrile |
| SMILES | CS(=O)(=O)c1ccc(-n2cc(C#N)nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H12ClN3O2S/c1-24(22,23)16-8-6-15(7-9-16)21-11-14(10-19)20-17(21)12-2-4-13(18)5-3-12/h2-9,11H,1H3 |
| InChIKey | UYBKGLYLRCILLW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |