C20H25ClN2O2S — CID 142972573
2-[(E)-but-2-en-2-yl]-4-methyl-1-(4-methylsulfonylphenyl)imidazole;(3E)-3-chloropenta-1,3-diene (PubChem CID 142972573) has the molecular formula C20H25ClN2O2S and a molecular weight of 392.95 g/mol. Its IUPAC name is 2-[(E)-but-2-en-2-yl]-4-methyl-1-(4-methylsulfonylphenyl)imidazole;(3E)-3-chloropenta-1,3-diene.
| Compound Name | 2-[(E)-but-2-en-2-yl]-4-methyl-1-(4-methylsulfonylphenyl)imidazole;(3E)-3-chloropenta-1,3-diene |
|---|---|
| PubChem CID | 142972573 |
| Molecular Formula | C20H25ClN2O2S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[(E)-but-2-en-2-yl]-4-methyl-1-(4-methylsulfonylphenyl)imidazole;(3E)-3-chloropenta-1,3-diene |
| SMILES | C/C=C(\C)c1nc(C)cn1-c1ccc(S(C)(=O)=O)cc1.C=C/C(Cl)=C\C |
| InChI | InChI=1S/C15H18N2O2S.C5H7Cl/c1-5-11(2)15-16-12(3)10-17(15)13-6-8-14(9-7-13)20(4,18)19;1-3-5(6)4-2/h5-10H,1-4H3;3-4H,1H2,2H3/b11-5+;5-4+ |
| InChIKey | CAKWFNULIKIHQP-QTUYPQCBSA-N |
| XLogP | 5.32 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|