C19H17F5N2O2S — CID 142959138
acetylene;2-[(2E,4E)-5,6-difluorohexa-2,4-dien-3-yl]-1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazole (PubChem CID 142959138) has the molecular formula C19H17F5N2O2S and a molecular weight of 432.41 g/mol. Its IUPAC name is acetylene;2-[(2E,4E)-5,6-difluorohexa-2,4-dien-3-yl]-1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazole.
| Compound Name | acetylene;2-[(2E,4E)-5,6-difluorohexa-2,4-dien-3-yl]-1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 142959138 |
| Molecular Formula | C19H17F5N2O2S |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | acetylene;2-[(2E,4E)-5,6-difluorohexa-2,4-dien-3-yl]-1-(4-methylsulfonylphenyl)-4-(trifluoromethyl)imidazole |
| SMILES | C#C.C/C=C(\C=C(\F)CF)c1nc(C(F)(F)F)cn1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H15F5N2O2S.C2H2/c1-3-11(8-12(19)9-18)16-23-15(17(20,21)22)10-24(16)13-4-6-14(7-5-13)27(2,25)26;1-2/h3-8,10H,9H2,1-2H3;1-2H/b11-3+,12-8+; |
| InChIKey | VPKHBHCXRGSQBH-HWMWCPBLSA-N |
| XLogP | 4.77 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|