C16H17F2N3O2S — CID 142848575
(E)-2-[4-(difluoromethyl)-1-(4-methylsulfonylphenyl)imidazol-2-yl]-N-methylbut-2-en-1-imine (PubChem CID 142848575) has the molecular formula C16H17F2N3O2S and a molecular weight of 353.39 g/mol. Its IUPAC name is (E)-2-[4-(difluoromethyl)-1-(4-methylsulfonylphenyl)imidazol-2-yl]-N-methylbut-2-en-1-imine.
| Compound Name | (E)-2-[4-(difluoromethyl)-1-(4-methylsulfonylphenyl)imidazol-2-yl]-N-methylbut-2-en-1-imine |
|---|---|
| PubChem CID | 142848575 |
| Molecular Formula | C16H17F2N3O2S |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (E)-2-[4-(difluoromethyl)-1-(4-methylsulfonylphenyl)imidazol-2-yl]-N-methylbut-2-en-1-imine |
| SMILES | C/C=C(\C=N\C)c1nc(C(F)F)cn1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H17F2N3O2S/c1-4-11(9-19-2)16-20-14(15(17)18)10-21(16)12-5-7-13(8-6-12)24(3,22)23/h4-10,15H,1-3H3/b11-4+,19-9+ |
| InChIKey | LWDFJVGOBNLTLX-ZYQUUSSMSA-N |
| XLogP | 3.32 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|