C11H10Cl2FN3 — CID 107581408
1-(3,5-dichloro-4-fluorophenyl)-N,4-dimethylimidazol-2-amine (PubChem CID 107581408) has the molecular formula C11H10Cl2FN3 and a molecular weight of 274.13 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-fluorophenyl)-N,4-dimethylimidazol-2-amine.
| Compound Name | 1-(3,5-dichloro-4-fluorophenyl)-N,4-dimethylimidazol-2-amine |
|---|---|
| PubChem CID | 107581408 |
| Molecular Formula | C11H10Cl2FN3 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-(3,5-dichloro-4-fluorophenyl)-N,4-dimethylimidazol-2-amine |
| SMILES | CNc1nc(C)cn1-c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2FN3/c1-6-5-17(11(15-2)16-6)7-3-8(12)10(14)9(13)4-7/h3-5H,1-2H3,(H,15,16) |
| InChIKey | QXKZGEVDLYTDIV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|