C12H12FN3 — CID 106558712
1-cyclopropyl-N-(4-fluorophenyl)imidazol-2-amine (PubChem CID 106558712) has the molecular formula C12H12FN3 and a molecular weight of 217.25 g/mol. Its IUPAC name is 1-cyclopropyl-N-(4-fluorophenyl)imidazol-2-amine.
| Compound Name | 1-cyclopropyl-N-(4-fluorophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106558712 |
| Molecular Formula | C12H12FN3 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-cyclopropyl-N-(4-fluorophenyl)imidazol-2-amine |
| SMILES | Fc1ccc(Nc2nccn2C2CC2)cc1 |
| InChI | InChI=1S/C12H12FN3/c13-9-1-3-10(4-2-9)15-12-14-7-8-16(12)11-5-6-11/h1-4,7-8,11H,5-6H2,(H,14,15) |
| InChIKey | QRXFIMORTRYJEF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |