C15H17F2N3 — CID 106556886
1-cyclohexyl-N-(2,5-difluorophenyl)imidazol-2-amine (PubChem CID 106556886) has the molecular formula C15H17F2N3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-cyclohexyl-N-(2,5-difluorophenyl)imidazol-2-amine.
| Compound Name | 1-cyclohexyl-N-(2,5-difluorophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106556886 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-cyclohexyl-N-(2,5-difluorophenyl)imidazol-2-amine |
| SMILES | Fc1ccc(F)c(Nc2nccn2C2CCCCC2)c1 |
| InChI | InChI=1S/C15H17F2N3/c16-11-6-7-13(17)14(10-11)19-15-18-8-9-20(15)12-4-2-1-3-5-12/h6-10,12H,1-5H2,(H,18,19) |
| InChIKey | YGIXDMMUMFKVOW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |